C10H17N3O2S2 — CID 80585796
3,5-dimethyl-N-(thiolan-2-ylmethyl)-1H-pyrazole-4-sulfonamide (PubChem CID 80585796) has the molecular formula C10H17N3O2S2 and a molecular weight of 275.40 g/mol. Its IUPAC name is 3,5-dimethyl-N-(thiolan-2-ylmethyl)-1H-pyrazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-(thiolan-2-ylmethyl)-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 80585796 |
| Molecular Formula | C10H17N3O2S2 |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3,5-dimethyl-N-(thiolan-2-ylmethyl)-1H-pyrazole-4-sulfonamide |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)NCC1CCCS1 |
| InChI | InChI=1S/C10H17N3O2S2/c1-7-10(8(2)13-12-7)17(14,15)11-6-9-4-3-5-16-9/h9,11H,3-6H2,1-2H3,(H,12,13) |
| InChIKey | QHOJGXZDAOYNHP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |