C7H9IN2S2 — CID 80596236
2-iodo-5-(thian-2-yl)-1,3,4-thiadiazole (PubChem CID 80596236) has the molecular formula C7H9IN2S2 and a molecular weight of 312.20 g/mol. Its IUPAC name is 2-iodo-5-(thian-2-yl)-1,3,4-thiadiazole.
| Compound Name | 2-iodo-5-(thian-2-yl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 80596236 |
| Molecular Formula | C7H9IN2S2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.93 |
| IUPAC Name | 2-iodo-5-(thian-2-yl)-1,3,4-thiadiazole |
| SMILES | Ic1nnc(C2CCCCS2)s1 |
| InChI | InChI=1S/C7H9IN2S2/c8-7-10-9-6(12-7)5-3-1-2-4-11-5/h5H,1-4H2 |
| InChIKey | UTKGCNQJNKMLFG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|