C12H15IN2S — CID 81096255
2-(2-adamantyl)-5-iodo-1,3,4-thiadiazole (PubChem CID 81096255) has the molecular formula C12H15IN2S and a molecular weight of 346.24 g/mol. Its IUPAC name is 2-(2-adamantyl)-5-iodo-1,3,4-thiadiazole.
| Compound Name | 2-(2-adamantyl)-5-iodo-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 81096255 |
| Molecular Formula | C12H15IN2S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2-(2-adamantyl)-5-iodo-1,3,4-thiadiazole |
| SMILES | Ic1nnc(C2C3CC4CC(C3)CC2C4)s1 |
| InChI | InChI=1S/C12H15IN2S/c13-12-15-14-11(16-12)10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2 |
| InChIKey | RIEMPIOWCINUBY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|