C13H19N5 — CID 115998290
6-(2-adamantyl)-1,3,5-triazine-2,4-diamine (PubChem CID 115998290) has the molecular formula C13H19N5 and a molecular weight of 245.33 g/mol. Its IUPAC name is 6-(2-adamantyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(2-adamantyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 115998290 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 6-(2-adamantyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(C2C3CC4CC(C3)CC2C4)n1 |
| InChI | InChI=1S/C13H19N5/c14-12-16-11(17-13(15)18-12)10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2,(H4,14,15,16,17,18) |
| InChIKey | DHLQAEXPTLSHCK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |