C12H11BrF3N3O2 — CID 80597937
N-[3-bromo-5-(trifluoromethyl)phenyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclopropane-1-carboxamide (PubChem CID 80597937) has the molecular formula C12H11BrF3N3O2 and a molecular weight of 366.14 g/mol. Its IUPAC name is N-[3-bromo-5-(trifluoromethyl)phenyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclopropane-1-carboxamide.
| Compound Name | N-[3-bromo-5-(trifluoromethyl)phenyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 80597937 |
| Molecular Formula | C12H11BrF3N3O2 |
| Molecular Weight | 366.14 g/mol |
| Exact Mass | 365.00 |
| IUPAC Name | N-[3-bromo-5-(trifluoromethyl)phenyl]-1-[(E)-N'-hydroxycarbamimidoyl]cyclopropane-1-carboxamide |
| SMILES | N/C(=N/O)C1(C(=O)Nc2cc(Br)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C12H11BrF3N3O2/c13-7-3-6(12(14,15)16)4-8(5-7)18-10(20)11(1-2-11)9(17)19-21/h3-5,21H,1-2H2,(H2,17,19)(H,18,20) |
| InChIKey | QWBVPVQUMMFQBZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|