C7H6IN5OS — CID 80607744
3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one (PubChem CID 80607744) has the molecular formula C7H6IN5OS and a molecular weight of 335.13 g/mol. Its IUPAC name is 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one.
| Compound Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one |
|---|---|
| PubChem CID | 80607744 |
| Molecular Formula | C7H6IN5OS |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 334.93 |
| IUPAC Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-5-iodopyrimidin-4-one |
| SMILES | Nc1nnc(Cn2cncc(I)c2=O)s1 |
| InChI | InChI=1S/C7H6IN5OS/c8-4-1-10-3-13(6(4)14)2-5-11-12-7(9)15-5/h1,3H,2H2,(H2,9,12) |
| InChIKey | RCWBJXDRARHZBS-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|