C8H8IN5OS — CID 80608295
3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-5-iodo-2-methylpyrimidin-4-one (PubChem CID 80608295) has the molecular formula C8H8IN5OS and a molecular weight of 349.16 g/mol. Its IUPAC name is 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-5-iodo-2-methylpyrimidin-4-one.
| Compound Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-5-iodo-2-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 80608295 |
| Molecular Formula | C8H8IN5OS |
| Molecular Weight | 349.16 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)methyl]-5-iodo-2-methylpyrimidin-4-one |
| SMILES | Cc1ncc(I)c(=O)n1Cc1nnc(N)s1 |
| InChI | InChI=1S/C8H8IN5OS/c1-4-11-2-5(9)7(15)14(4)3-6-12-13-8(10)16-6/h2H,3H2,1H3,(H2,10,13) |
| InChIKey | XTPYSISOLXPGNN-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.16 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|