C12H19N5OS — CID 80623450
1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[5-(methylamino)-1,3,4-thiadiazol-2-yl]methanone (PubChem CID 80623450) has the molecular formula C12H19N5OS and a molecular weight of 281.38 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[5-(methylamino)-1,3,4-thiadiazol-2-yl]methanone.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[5-(methylamino)-1,3,4-thiadiazol-2-yl]methanone |
|---|---|
| PubChem CID | 80623450 |
| Molecular Formula | C12H19N5OS |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl-[5-(methylamino)-1,3,4-thiadiazol-2-yl]methanone |
| SMILES | CNc1nnc(C(=O)N2CCN3CCCCC3C2)s1 |
| InChI | InChI=1S/C12H19N5OS/c1-13-12-15-14-10(19-12)11(18)17-7-6-16-5-3-2-4-9(16)8-17/h9H,2-8H2,1H3,(H,13,15) |
| InChIKey | ITPQJADNHWJNOV-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |