C9H9F3N2O3 — CID 80643708
5-acetyl-3-(3,3,3-trifluoropropyl)-1H-pyrimidine-2,4-dione (PubChem CID 80643708) has the molecular formula C9H9F3N2O3 and a molecular weight of 250.18 g/mol. Its IUPAC name is 5-acetyl-3-(3,3,3-trifluoropropyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-acetyl-3-(3,3,3-trifluoropropyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 80643708 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 5-acetyl-3-(3,3,3-trifluoropropyl)-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)c1c[nH]c(=O)n(CCC(F)(F)F)c1=O |
| InChI | InChI=1S/C9H9F3N2O3/c1-5(15)6-4-13-8(17)14(7(6)16)3-2-9(10,11)12/h4H,2-3H2,1H3,(H,13,17) |
| InChIKey | YTRABFZRXLCYIN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |