C14H18N4 — CID 80648565
N-(2,3-dihydro-1H-indol-7-ylmethyl)-2-imidazol-1-ylethanamine (PubChem CID 80648565) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)-2-imidazol-1-ylethanamine.
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-2-imidazol-1-ylethanamine |
|---|---|
| PubChem CID | 80648565 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-2-imidazol-1-ylethanamine |
| SMILES | c1cc2c(c(CNCCn3ccnc3)c1)NCC2 |
| InChI | InChI=1S/C14H18N4/c1-2-12-4-5-17-14(12)13(3-1)10-15-6-8-18-9-7-16-11-18/h1-3,7,9,11,15,17H,4-6,8,10H2 |
| InChIKey | DIUXDLJPNQNAJV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|