C23H22N2O4S — CID 80655207
methyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-thiazol-4-yl]butanoate (PubChem CID 80655207) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is methyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-thiazol-4-yl]butanoate.
| Compound Name | methyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-thiazol-4-yl]butanoate |
|---|---|
| PubChem CID | 80655207 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | methyl 4-[2-(9H-fluoren-9-ylmethoxycarbonylamino)-1,3-thiazol-4-yl]butanoate |
| SMILES | COC(=O)CCCc1csc(NC(=O)OCC2c3ccccc3-c3ccccc32)n1 |
| InChI | InChI=1S/C23H22N2O4S/c1-28-21(26)12-6-7-15-14-30-22(24-15)25-23(27)29-13-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h2-5,8-11,14,20H,6-7,12-13H2,1H3,(H,24,25,27) |
| InChIKey | VZZAKDATOCEVNZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |