C21H24N2O4S — CID 59336391
methyl 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methylsulfanylamino]butanoate (PubChem CID 59336391) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is methyl 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methylsulfanylamino]butanoate.
| Compound Name | methyl 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methylsulfanylamino]butanoate |
|---|---|
| PubChem CID | 59336391 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | methyl 4-[(9H-fluoren-9-ylmethoxycarbonylamino)methylsulfanylamino]butanoate |
| SMILES | COC(=O)CCCNSCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H24N2O4S/c1-26-20(24)11-6-12-23-28-14-22-21(25)27-13-19-17-9-4-2-7-15(17)16-8-3-5-10-18(16)19/h2-5,7-10,19,23H,6,11-14H2,1H3,(H,22,25) |
| InChIKey | HGXASBFSJUAUJP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|