C16H15BrN4 — CID 80674401
N-benzyl-N-(2-bromoethyl)pyrido[2,3-b]pyrazin-6-amine (PubChem CID 80674401) has the molecular formula C16H15BrN4 and a molecular weight of 343.23 g/mol. Its IUPAC name is N-benzyl-N-(2-bromoethyl)pyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-benzyl-N-(2-bromoethyl)pyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 80674401 |
| Molecular Formula | C16H15BrN4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-benzyl-N-(2-bromoethyl)pyrido[2,3-b]pyrazin-6-amine |
| SMILES | BrCCN(Cc1ccccc1)c1ccc2nccnc2n1 |
| InChI | InChI=1S/C16H15BrN4/c17-8-11-21(12-13-4-2-1-3-5-13)15-7-6-14-16(20-15)19-10-9-18-14/h1-7,9-10H,8,11-12H2 |
| InChIKey | CTBUAGNLSWKZBN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|