C11H13BrN4 — CID 80672504
N-(2-bromoethyl)-N-ethylpyrido[2,3-b]pyrazin-6-amine (PubChem CID 80672504) has the molecular formula C11H13BrN4 and a molecular weight of 281.16 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-ethylpyrido[2,3-b]pyrazin-6-amine.
| Compound Name | N-(2-bromoethyl)-N-ethylpyrido[2,3-b]pyrazin-6-amine |
|---|---|
| PubChem CID | 80672504 |
| Molecular Formula | C11H13BrN4 |
| Molecular Weight | 281.16 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | N-(2-bromoethyl)-N-ethylpyrido[2,3-b]pyrazin-6-amine |
| SMILES | CCN(CCBr)c1ccc2nccnc2n1 |
| InChI | InChI=1S/C11H13BrN4/c1-2-16(8-5-12)10-4-3-9-11(15-10)14-7-6-13-9/h3-4,6-7H,2,5,8H2,1H3 |
| InChIKey | GRZXFIMUHQMHER-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.16 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|