C8H7ClN4OS — CID 80688454
4-chloro-2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 80688454) has the molecular formula C8H7ClN4OS and a molecular weight of 242.69 g/mol. Its IUPAC name is 4-chloro-2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 80688454 |
| Molecular Formula | C8H7ClN4OS |
| Molecular Weight | 242.69 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 4-chloro-2-(3,5-dimethyl-1,2,4-triazol-1-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | Cc1nc(C)n(-c2nc(Cl)c(C=O)s2)n1 |
| InChI | InChI=1S/C8H7ClN4OS/c1-4-10-5(2)13(12-4)8-11-7(9)6(3-14)15-8/h3H,1-2H3 |
| InChIKey | NJFPOTHZSIHVGS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|