C10H11ClN2OS — CID 106315180
4-chloro-2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 106315180) has the molecular formula C10H11ClN2OS and a molecular weight of 242.73 g/mol. Its IUPAC name is 4-chloro-2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-chloro-2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 106315180 |
| Molecular Formula | C10H11ClN2OS |
| Molecular Weight | 242.73 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 4-chloro-2-(5-methyl-3,6-dihydro-2H-pyridin-1-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CC1=CCCN(c2nc(Cl)c(C=O)s2)C1 |
| InChI | InChI=1S/C10H11ClN2OS/c1-7-3-2-4-13(5-7)10-12-9(11)8(6-14)15-10/h3,6H,2,4-5H2,1H3 |
| InChIKey | VYBURENMCOQPGV-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.73 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|