C7H10N2O3 — CID 80718904
3-(2,3-dihydroxypropyl)pyrimidin-4-one (PubChem CID 80718904) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyl)pyrimidin-4-one.
| Compound Name | 3-(2,3-dihydroxypropyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 80718904 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 3-(2,3-dihydroxypropyl)pyrimidin-4-one |
| SMILES | O=c1ccncn1CC(O)CO |
| InChI | InChI=1S/C7H10N2O3/c10-4-6(11)3-9-5-8-2-1-7(9)12/h1-2,5-6,10-11H,3-4H2 |
| InChIKey | LPWWKGSVMGPHPA-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |