C11H21N3O4 — CID 80757650
(2R)-2-[(1-ethylpyrrolidin-2-yl)methylcarbamoylamino]-3-hydroxypropanoic acid (PubChem CID 80757650) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2R)-2-[(1-ethylpyrrolidin-2-yl)methylcarbamoylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(1-ethylpyrrolidin-2-yl)methylcarbamoylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80757650 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | (2R)-2-[(1-ethylpyrrolidin-2-yl)methylcarbamoylamino]-3-hydroxypropanoic acid |
| SMILES | CCN1CCCC1CNC(=O)N[C@H](CO)C(=O)O |
| InChI | InChI=1S/C11H21N3O4/c1-2-14-5-3-4-8(14)6-12-11(18)13-9(7-15)10(16)17/h8-9,15H,2-7H2,1H3,(H,16,17)(H2,12,13,18)/t8?,9-/m1/s1 |
| InChIKey | NBJPGWPARPEMRE-YGPZHTELSA-N |
| XLogP | -0.78 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |