C15H24ClN5 — CID 80823245
6-chloro-4-N-ethyl-2-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-1,3,5-triazine-2,4-diamine (PubChem CID 80823245) has the molecular formula C15H24ClN5 and a molecular weight of 309.85 g/mol. Its IUPAC name is 6-chloro-4-N-ethyl-2-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-chloro-4-N-ethyl-2-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 80823245 |
| Molecular Formula | C15H24ClN5 |
| Molecular Weight | 309.85 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | 6-chloro-4-N-ethyl-2-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-1,3,5-triazine-2,4-diamine |
| SMILES | CCNc1nc(Cl)nc(NC2C3(C)CCC(C3)C2(C)C)n1 |
| InChI | InChI=1S/C15H24ClN5/c1-5-17-12-19-11(16)20-13(21-12)18-10-14(2,3)9-6-7-15(10,4)8-9/h9-10H,5-8H2,1-4H3,(H2,17,18,19,20,21) |
| InChIKey | IPXLFKSVJMLRQR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.85 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |