C14H26N6O — CID 80823753
1-[4-[2-amino-6-(ethylamino)pyrimidin-4-yl]piperazin-1-yl]-2-methylpropan-2-ol (PubChem CID 80823753) has the molecular formula C14H26N6O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1-[4-[2-amino-6-(ethylamino)pyrimidin-4-yl]piperazin-1-yl]-2-methylpropan-2-ol.
| Compound Name | 1-[4-[2-amino-6-(ethylamino)pyrimidin-4-yl]piperazin-1-yl]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 80823753 |
| Molecular Formula | C14H26N6O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 1-[4-[2-amino-6-(ethylamino)pyrimidin-4-yl]piperazin-1-yl]-2-methylpropan-2-ol |
| SMILES | CCNc1cc(N2CCN(CC(C)(C)O)CC2)nc(N)n1 |
| InChI | InChI=1S/C14H26N6O/c1-4-16-11-9-12(18-13(15)17-11)20-7-5-19(6-8-20)10-14(2,3)21/h9,21H,4-8,10H2,1-3H3,(H3,15,16,17,18) |
| InChIKey | BFRLVMKOKADHSF-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |