C14H17N5 — CID 80822823
6-(1,3-dihydroisoindol-2-yl)-4-N-ethylpyrimidine-2,4-diamine (PubChem CID 80822823) has the molecular formula C14H17N5 and a molecular weight of 255.33 g/mol. Its IUPAC name is 6-(1,3-dihydroisoindol-2-yl)-4-N-ethylpyrimidine-2,4-diamine.
| Compound Name | 6-(1,3-dihydroisoindol-2-yl)-4-N-ethylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80822823 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 6-(1,3-dihydroisoindol-2-yl)-4-N-ethylpyrimidine-2,4-diamine |
| SMILES | CCNc1cc(N2Cc3ccccc3C2)nc(N)n1 |
| InChI | InChI=1S/C14H17N5/c1-2-16-12-7-13(18-14(15)17-12)19-8-10-5-3-4-6-11(10)9-19/h3-7H,2,8-9H2,1H3,(H3,15,16,17,18) |
| InChIKey | WKIRTNFFBKNFLA-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |