C14H24N6O — CID 80837412
4-methoxy-N-methyl-6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3,5-triazin-2-amine (PubChem CID 80837412) has the molecular formula C14H24N6O and a molecular weight of 292.39 g/mol. Its IUPAC name is 4-methoxy-N-methyl-6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3,5-triazin-2-amine.
| Compound Name | 4-methoxy-N-methyl-6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80837412 |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 4-methoxy-N-methyl-6-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(OC)nc(N2CC3CCCCN3CC2C)n1 |
| InChI | InChI=1S/C14H24N6O/c1-10-8-19-7-5-4-6-11(19)9-20(10)13-16-12(15-2)17-14(18-13)21-3/h10-11H,4-9H2,1-3H3,(H,15,16,17,18) |
| InChIKey | PBJXVDJYWDSMBQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |