C14H18N4O2 — CID 80863931
4-(2,3-dimethylphenoxy)-6-propan-2-yloxy-1,3,5-triazin-2-amine (PubChem CID 80863931) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 4-(2,3-dimethylphenoxy)-6-propan-2-yloxy-1,3,5-triazin-2-amine.
| Compound Name | 4-(2,3-dimethylphenoxy)-6-propan-2-yloxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80863931 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 4-(2,3-dimethylphenoxy)-6-propan-2-yloxy-1,3,5-triazin-2-amine |
| SMILES | Cc1cccc(Oc2nc(N)nc(OC(C)C)n2)c1C |
| InChI | InChI=1S/C14H18N4O2/c1-8(2)19-13-16-12(15)17-14(18-13)20-11-7-5-6-9(3)10(11)4/h5-8H,1-4H3,(H2,15,16,17,18) |
| InChIKey | XVUKXZQBTVGUIU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |