C12H16N6O2 — CID 80872070
4-imidazol-1-yl-N-methyl-6-(oxan-4-yloxy)-1,3,5-triazin-2-amine (PubChem CID 80872070) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 4-imidazol-1-yl-N-methyl-6-(oxan-4-yloxy)-1,3,5-triazin-2-amine.
| Compound Name | 4-imidazol-1-yl-N-methyl-6-(oxan-4-yloxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80872070 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-imidazol-1-yl-N-methyl-6-(oxan-4-yloxy)-1,3,5-triazin-2-amine |
| SMILES | CNc1nc(OC2CCOCC2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C12H16N6O2/c1-13-10-15-11(18-5-4-14-8-18)17-12(16-10)20-9-2-6-19-7-3-9/h4-5,8-9H,2-3,6-7H2,1H3,(H,13,15,16,17) |
| InChIKey | CDPFSGJRODJNLF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |