C9H11N5OS2 — CID 80885392
N-ethyl-4-methoxy-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 80885392) has the molecular formula C9H11N5OS2 and a molecular weight of 269.36 g/mol. Its IUPAC name is N-ethyl-4-methoxy-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-methoxy-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80885392 |
| Molecular Formula | C9H11N5OS2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-ethyl-4-methoxy-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(OC)nc(Sc2nccs2)n1 |
| InChI | InChI=1S/C9H11N5OS2/c1-3-10-6-12-7(15-2)14-8(13-6)17-9-11-4-5-16-9/h4-5H,3H2,1-2H3,(H,10,12,13,14) |
| InChIKey | GPTVYKCCBCBOOG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|