C7H5ClN4OS2 — CID 62859542
2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole (PubChem CID 62859542) has the molecular formula C7H5ClN4OS2 and a molecular weight of 260.73 g/mol. Its IUPAC name is 2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole.
| Compound Name | 2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole |
|---|---|
| PubChem CID | 62859542 |
| Molecular Formula | C7H5ClN4OS2 |
| Molecular Weight | 260.73 g/mol |
| Exact Mass | 259.96 |
| IUPAC Name | 2-[(4-chloro-6-methoxy-1,3,5-triazin-2-yl)sulfanyl]-1,3-thiazole |
| SMILES | COc1nc(Cl)nc(Sc2nccs2)n1 |
| InChI | InChI=1S/C7H5ClN4OS2/c1-13-5-10-4(8)11-6(12-5)15-7-9-2-3-14-7/h2-3H,1H3 |
| InChIKey | BNHGHSBBDBFTCE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.73 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|