C7H8N6OS2 — CID 80923215
[4-methoxy-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80923215) has the molecular formula C7H8N6OS2 and a molecular weight of 256.32 g/mol. Its IUPAC name is [4-methoxy-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-methoxy-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80923215 |
| Molecular Formula | C7H8N6OS2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | [4-methoxy-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-yl]hydrazine |
| SMILES | COc1nc(NN)nc(Sc2nccs2)n1 |
| InChI | InChI=1S/C7H8N6OS2/c1-14-5-10-4(13-8)11-6(12-5)16-7-9-2-3-15-7/h2-3H,8H2,1H3,(H,10,11,12,13) |
| InChIKey | NVXYMAVPQDKUJF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|