C12H16N6S2 — CID 80885488
N-ethyl-4-pyrrolidin-1-yl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine (PubChem CID 80885488) has the molecular formula C12H16N6S2 and a molecular weight of 308.44 g/mol. Its IUPAC name is N-ethyl-4-pyrrolidin-1-yl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine.
| Compound Name | N-ethyl-4-pyrrolidin-1-yl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80885488 |
| Molecular Formula | C12H16N6S2 |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-ethyl-4-pyrrolidin-1-yl-6-(1,3-thiazol-2-ylsulfanyl)-1,3,5-triazin-2-amine |
| SMILES | CCNc1nc(Sc2nccs2)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C12H16N6S2/c1-2-13-9-15-10(18-6-3-4-7-18)17-11(16-9)20-12-14-5-8-19-12/h5,8H,2-4,6-7H2,1H3,(H,13,15,16,17) |
| InChIKey | PANVDLXERDMPKV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|