C11H9Cl2N3S — CID 80890874
6-(3,4-dichlorophenyl)sulfanyl-N-methylpyrimidin-4-amine (PubChem CID 80890874) has the molecular formula C11H9Cl2N3S and a molecular weight of 286.19 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)sulfanyl-N-methylpyrimidin-4-amine.
| Compound Name | 6-(3,4-dichlorophenyl)sulfanyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80890874 |
| Molecular Formula | C11H9Cl2N3S |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | 6-(3,4-dichlorophenyl)sulfanyl-N-methylpyrimidin-4-amine |
| SMILES | CNc1cc(Sc2ccc(Cl)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C11H9Cl2N3S/c1-14-10-5-11(16-6-15-10)17-7-2-3-8(12)9(13)4-7/h2-6H,1H3,(H,14,15,16) |
| InChIKey | WNEYEPLTEMETPN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |