C9H15FN4S — CID 80894473
4-[2-(dimethylamino)ethylsulfanyl]-5-fluoro-N-methylpyrimidin-2-amine (PubChem CID 80894473) has the molecular formula C9H15FN4S and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-[2-(dimethylamino)ethylsulfanyl]-5-fluoro-N-methylpyrimidin-2-amine.
| Compound Name | 4-[2-(dimethylamino)ethylsulfanyl]-5-fluoro-N-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80894473 |
| Molecular Formula | C9H15FN4S |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 4-[2-(dimethylamino)ethylsulfanyl]-5-fluoro-N-methylpyrimidin-2-amine |
| SMILES | CNc1ncc(F)c(SCCN(C)C)n1 |
| InChI | InChI=1S/C9H15FN4S/c1-11-9-12-6-7(10)8(13-9)15-5-4-14(2)3/h6H,4-5H2,1-3H3,(H,11,12,13) |
| InChIKey | GNQYUBYKIONLAX-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |