C11H16ClN7O — CID 80901059
[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-6-propoxy-1,3,5-triazin-2-yl]hydrazine (PubChem CID 80901059) has the molecular formula C11H16ClN7O and a molecular weight of 297.75 g/mol. Its IUPAC name is [4-(4-chloro-3,5-dimethylpyrazol-1-yl)-6-propoxy-1,3,5-triazin-2-yl]hydrazine.
| Compound Name | [4-(4-chloro-3,5-dimethylpyrazol-1-yl)-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80901059 |
| Molecular Formula | C11H16ClN7O |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | [4-(4-chloro-3,5-dimethylpyrazol-1-yl)-6-propoxy-1,3,5-triazin-2-yl]hydrazine |
| SMILES | CCCOc1nc(NN)nc(-n2nc(C)c(Cl)c2C)n1 |
| InChI | InChI=1S/C11H16ClN7O/c1-4-5-20-11-15-9(17-13)14-10(16-11)19-7(3)8(12)6(2)18-19/h4-5,13H2,1-3H3,(H,14,15,16,17) |
| InChIKey | COPITZUMASBAOL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 103.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|