C8H11ClF3N5 — CID 80901823
5-chloro-N-ethyl-2-hydrazinyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine (PubChem CID 80901823) has the molecular formula C8H11ClF3N5 and a molecular weight of 269.66 g/mol. Its IUPAC name is 5-chloro-N-ethyl-2-hydrazinyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine.
| Compound Name | 5-chloro-N-ethyl-2-hydrazinyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 80901823 |
| Molecular Formula | C8H11ClF3N5 |
| Molecular Weight | 269.66 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 5-chloro-N-ethyl-2-hydrazinyl-N-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
| SMILES | CCN(CC(F)(F)F)c1nc(NN)ncc1Cl |
| InChI | InChI=1S/C8H11ClF3N5/c1-2-17(4-8(10,11)12)6-5(9)3-14-7(15-6)16-13/h3H,2,4,13H2,1H3,(H,14,15,16) |
| InChIKey | OSXDHFVSJOMQBG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.66 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|