C9H11FN6 — CID 80901964
[4-(3,5-dimethylpyrazol-1-yl)-5-fluoropyrimidin-2-yl]hydrazine (PubChem CID 80901964) has the molecular formula C9H11FN6 and a molecular weight of 222.23 g/mol. Its IUPAC name is [4-(3,5-dimethylpyrazol-1-yl)-5-fluoropyrimidin-2-yl]hydrazine.
| Compound Name | [4-(3,5-dimethylpyrazol-1-yl)-5-fluoropyrimidin-2-yl]hydrazine |
|---|---|
| PubChem CID | 80901964 |
| Molecular Formula | C9H11FN6 |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | [4-(3,5-dimethylpyrazol-1-yl)-5-fluoropyrimidin-2-yl]hydrazine |
| SMILES | Cc1cc(C)n(-c2nc(NN)ncc2F)n1 |
| InChI | InChI=1S/C9H11FN6/c1-5-3-6(2)16(15-5)8-7(10)4-12-9(13-8)14-11/h3-4H,11H2,1-2H3,(H,12,13,14) |
| InChIKey | XLMKNDFWTGHLRK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|