C11H22N8O — CID 80911433
N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine (PubChem CID 80911433) has the molecular formula C11H22N8O and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine.
| Compound Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80911433 |
| Molecular Formula | C11H22N8O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | N-[(1,4-dimethylpiperazin-2-yl)methyl]-4-hydrazinyl-6-methoxy-1,3,5-triazin-2-amine |
| SMILES | COc1nc(NN)nc(NCC2CN(C)CCN2C)n1 |
| InChI | InChI=1S/C11H22N8O/c1-18-4-5-19(2)8(7-18)6-13-9-14-10(17-12)16-11(15-9)20-3/h8H,4-7,12H2,1-3H3,(H2,13,14,15,16,17) |
| InChIKey | MIRMRYPGMGKDNB-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|