C10H17N5S — CID 80913366
[6-(2,6-dimethylthiomorpholin-4-yl)pyrimidin-4-yl]hydrazine (PubChem CID 80913366) has the molecular formula C10H17N5S and a molecular weight of 239.35 g/mol. Its IUPAC name is [6-(2,6-dimethylthiomorpholin-4-yl)pyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2,6-dimethylthiomorpholin-4-yl)pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 80913366 |
| Molecular Formula | C10H17N5S |
| Molecular Weight | 239.35 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | [6-(2,6-dimethylthiomorpholin-4-yl)pyrimidin-4-yl]hydrazine |
| SMILES | CC1CN(c2cc(NN)ncn2)CC(C)S1 |
| InChI | InChI=1S/C10H17N5S/c1-7-4-15(5-8(2)16-7)10-3-9(14-11)12-6-13-10/h3,6-8H,4-5,11H2,1-2H3,(H,12,13,14) |
| InChIKey | KZICXPRJBUUYNJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|