C9H9BrFN5S — CID 80917949
N-[(4-bromothiophen-2-yl)methyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine (PubChem CID 80917949) has the molecular formula C9H9BrFN5S and a molecular weight of 318.18 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine |
|---|---|
| PubChem CID | 80917949 |
| Molecular Formula | C9H9BrFN5S |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-5-fluoro-2-hydrazinylpyrimidin-4-amine |
| SMILES | NNc1ncc(F)c(NCc2cc(Br)cs2)n1 |
| InChI | InChI=1S/C9H9BrFN5S/c10-5-1-6(17-4-5)2-13-8-7(11)3-14-9(15-8)16-12/h1,3-4H,2,12H2,(H2,13,14,15,16) |
| InChIKey | MBNHZOLFJGAULR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|