C14H28N6 — CID 80963806
3-N-(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)-1-N,1-N-dimethylbutane-1,3-diamine (PubChem CID 80963806) has the molecular formula C14H28N6 and a molecular weight of 280.42 g/mol. Its IUPAC name is 3-N-(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)-1-N,1-N-dimethylbutane-1,3-diamine.
| Compound Name | 3-N-(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)-1-N,1-N-dimethylbutane-1,3-diamine |
|---|---|
| PubChem CID | 80963806 |
| Molecular Formula | C14H28N6 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 3-N-(2-tert-butyl-6-hydrazinylpyrimidin-4-yl)-1-N,1-N-dimethylbutane-1,3-diamine |
| SMILES | CC(CCN(C)C)Nc1cc(NN)nc(C(C)(C)C)n1 |
| InChI | InChI=1S/C14H28N6/c1-10(7-8-20(5)6)16-11-9-12(19-15)18-13(17-11)14(2,3)4/h9-10H,7-8,15H2,1-6H3,(H2,16,17,18,19) |
| InChIKey | FJSDQKNCANPBFL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|