C12H14F3N — CID 81016865
N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclobutyl]methanamine (PubChem CID 81016865) has the molecular formula C12H14F3N and a molecular weight of 229.24 g/mol. Its IUPAC name is N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclobutyl]methanamine.
| Compound Name | N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 81016865 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-methyl-1-[2-(2,3,4-trifluorophenyl)cyclobutyl]methanamine |
| SMILES | CNCC1CCC1c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H14F3N/c1-16-6-7-2-3-8(7)9-4-5-10(13)12(15)11(9)14/h4-5,7-8,16H,2-3,6H2,1H3 |
| InChIKey | MPGNKRMORTXHOR-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|