(4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate

C16H22ClNO2 — CID 81046293

IUPAC(4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate
SMILESCC(CC(=O)OCc1ccc(Cl)cc1)C1CCCNC1
InChIInChI=1S/C16H22ClNO2/c1-12(14-3-2-8-18-10-14)9-16(19)20-11-13-4-6-15(17)7-5-13/h4-7,12,14,18H,2-3,8-11H2,1H3
InChIKeySRKCLGWCNWRKLP-UHFFFAOYSA-N
MW295.81 g/mol
LogP3.41
Rot. Bonds5

About (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate

(4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate (PubChem CID 81046293) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate.

Molecular Properties

Compound Name(4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate
PubChem CID81046293
Molecular FormulaC16H22ClNO2
Molecular Weight295.81 g/mol
Exact Mass295.13
IUPAC Name(4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate
SMILESCC(CC(=O)OCc1ccc(Cl)cc1)C1CCCNC1
InChIInChI=1S/C16H22ClNO2/c1-12(14-3-2-8-18-10-14)9-16(19)20-11-13-4-6-15(17)7-5-13/h4-7,12,14,18H,2-3,8-11H2,1H3
InChIKeySRKCLGWCNWRKLP-UHFFFAOYSA-N
XLogP3.41
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.81
LogP ≤ 53.41
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate?
The IUPAC name of (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate (CID 81046293) is (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate.
What is the SMILES notation for (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate?
The canonical SMILES for (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate is CC(CC(=O)OCc1ccc(Cl)cc1)C1CCCNC1.
What is the InChIKey of (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate?
The InChIKey is SRKCLGWCNWRKLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22ClNO2/c1-12(14-3-2-8-18-10-14)9-16(19)20-11-13-4-6-15(17)7-5-13/h4-7,12,14,18H,2-3,8-11H2,1H3.
What are the key properties of (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate?
(4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate has a molecular weight of 295.81 g/mol, XLogP of 3.41, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chlorophenyl)methyl 3-piperidin-3-ylbutanoate is sourced from PubChem (CID 81046293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).