C16H28BrNO2 — CID 81103925
2-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81103925) has the molecular formula C16H28BrNO2 and a molecular weight of 346.31 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81103925 |
| Molecular Formula | C16H28BrNO2 |
| Molecular Weight | 346.31 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-[[4-(bromomethyl)oxan-4-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | OC12CCCCC1CN(CC1(CBr)CCOCC1)CC2 |
| InChI | InChI=1S/C16H28BrNO2/c17-12-15(6-9-20-10-7-15)13-18-8-5-16(19)4-2-1-3-14(16)11-18/h14,19H,1-13H2 |
| InChIKey | LDXBMDJBLMLBTL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|