C16H29NO2S — CID 81116031
2-[[4-(sulfanylmethyl)oxan-4-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81116031) has the molecular formula C16H29NO2S and a molecular weight of 299.48 g/mol. Its IUPAC name is 2-[[4-(sulfanylmethyl)oxan-4-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[[4-(sulfanylmethyl)oxan-4-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81116031 |
| Molecular Formula | C16H29NO2S |
| Molecular Weight | 299.48 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 2-[[4-(sulfanylmethyl)oxan-4-yl]methyl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | OC12CCCCC1CN(CC1(CS)CCOCC1)CC2 |
| InChI | InChI=1S/C16H29NO2S/c18-16-4-2-1-3-14(16)11-17(8-5-16)12-15(13-20)6-9-19-10-7-15/h14,18,20H,1-13H2 |
| InChIKey | MLPRMPNDPKIMGS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.48 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|