C13H20ClN5O — CID 81109320
2-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 81109320) has the molecular formula C13H20ClN5O and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 81109320 |
| Molecular Formula | C13H20ClN5O |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 2-[4-chloro-6-(methylamino)-1,3,5-triazin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CNc1nc(Cl)nc(N2CCC3(O)CCCCC3C2)n1 |
| InChI | InChI=1S/C13H20ClN5O/c1-15-11-16-10(14)17-12(18-11)19-7-6-13(20)5-3-2-4-9(13)8-19/h9,20H,2-8H2,1H3,(H,15,16,17,18) |
| InChIKey | RTXBSQNHMRKREZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |