C17H29N5O — CID 133420780
2-[4-(dimethylamino)-6-propan-2-yl-1,3,5-triazin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol (PubChem CID 133420780) has the molecular formula C17H29N5O and a molecular weight of 319.45 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-6-propan-2-yl-1,3,5-triazin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol.
| Compound Name | 2-[4-(dimethylamino)-6-propan-2-yl-1,3,5-triazin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
|---|---|
| PubChem CID | 133420780 |
| Molecular Formula | C17H29N5O |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.24 |
| IUPAC Name | 2-[4-(dimethylamino)-6-propan-2-yl-1,3,5-triazin-2-yl]-1,3,4,5,6,7,8,8a-octahydroisoquinolin-4a-ol |
| SMILES | CC(C)c1nc(N(C)C)nc(N2CCC3(O)CCCCC3C2)n1 |
| InChI | InChI=1S/C17H29N5O/c1-12(2)14-18-15(21(3)4)20-16(19-14)22-10-9-17(23)8-6-5-7-13(17)11-22/h12-13,23H,5-11H2,1-4H3 |
| InChIKey | GYFSDUMGCOWNSP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |