C13H11NO5S — CID 81118004
2-hydroxy-4-[(3-methoxythiophene-2-carbonyl)amino]benzoic acid (PubChem CID 81118004) has the molecular formula C13H11NO5S and a molecular weight of 293.30 g/mol. Its IUPAC name is 2-hydroxy-4-[(3-methoxythiophene-2-carbonyl)amino]benzoic acid.
| Compound Name | 2-hydroxy-4-[(3-methoxythiophene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 81118004 |
| Molecular Formula | C13H11NO5S |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 2-hydroxy-4-[(3-methoxythiophene-2-carbonyl)amino]benzoic acid |
| SMILES | COc1ccsc1C(=O)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C13H11NO5S/c1-19-10-4-5-20-11(10)12(16)14-7-2-3-8(13(17)18)9(15)6-7/h2-6,15H,1H3,(H,14,16)(H,17,18) |
| InChIKey | AGTLVYIQSFOGJE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |