C11H9N3OS — CID 81154209
1-benzothiophen-7-yl(2H-triazol-4-yl)methanol (PubChem CID 81154209) has the molecular formula C11H9N3OS and a molecular weight of 231.28 g/mol. Its IUPAC name is 1-benzothiophen-7-yl(2H-triazol-4-yl)methanol.
| Compound Name | 1-benzothiophen-7-yl(2H-triazol-4-yl)methanol |
|---|---|
| PubChem CID | 81154209 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 1-benzothiophen-7-yl(2H-triazol-4-yl)methanol |
| SMILES | OC(c1cn[nH]n1)c1cccc2ccsc12 |
| InChI | InChI=1S/C11H9N3OS/c15-10(9-6-12-14-13-9)8-3-1-2-7-4-5-16-11(7)8/h1-6,10,15H,(H,12,13,14) |
| InChIKey | QWTZNNHKBFFESM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |