C14H14FN3OS — CID 115834053
(6-fluoro-1-benzothiophen-2-yl)-(3-propyltriazol-4-yl)methanol (PubChem CID 115834053) has the molecular formula C14H14FN3OS and a molecular weight of 291.35 g/mol. Its IUPAC name is (6-fluoro-1-benzothiophen-2-yl)-(3-propyltriazol-4-yl)methanol.
| Compound Name | (6-fluoro-1-benzothiophen-2-yl)-(3-propyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 115834053 |
| Molecular Formula | C14H14FN3OS |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | (6-fluoro-1-benzothiophen-2-yl)-(3-propyltriazol-4-yl)methanol |
| SMILES | CCCn1nncc1C(O)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C14H14FN3OS/c1-2-5-18-11(8-16-17-18)14(19)13-6-9-3-4-10(15)7-12(9)20-13/h3-4,6-8,14,19H,2,5H2,1H3 |
| InChIKey | GANHLLFNIODABT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |