C12H10FN3OS — CID 115835976
(6-fluoro-1-benzothiophen-2-yl)-(3-methyltriazol-4-yl)methanol (PubChem CID 115835976) has the molecular formula C12H10FN3OS and a molecular weight of 263.30 g/mol. Its IUPAC name is (6-fluoro-1-benzothiophen-2-yl)-(3-methyltriazol-4-yl)methanol.
| Compound Name | (6-fluoro-1-benzothiophen-2-yl)-(3-methyltriazol-4-yl)methanol |
|---|---|
| PubChem CID | 115835976 |
| Molecular Formula | C12H10FN3OS |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | (6-fluoro-1-benzothiophen-2-yl)-(3-methyltriazol-4-yl)methanol |
| SMILES | Cn1nncc1C(O)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C12H10FN3OS/c1-16-9(6-14-15-16)12(17)11-4-7-2-3-8(13)5-10(7)18-11/h2-6,12,17H,1H3 |
| InChIKey | ZYMVFTGDRHDJMT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |