C13H16N2O — CID 81170977
N-(1,2-oxazol-3-ylmethyl)-3-phenylpropan-1-amine (PubChem CID 81170977) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is N-(1,2-oxazol-3-ylmethyl)-3-phenylpropan-1-amine.
| Compound Name | N-(1,2-oxazol-3-ylmethyl)-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 81170977 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | N-(1,2-oxazol-3-ylmethyl)-3-phenylpropan-1-amine |
| SMILES | c1ccc(CCCNCc2ccon2)cc1 |
| InChI | InChI=1S/C13H16N2O/c1-2-5-12(6-3-1)7-4-9-14-11-13-8-10-16-15-13/h1-3,5-6,8,10,14H,4,7,9,11H2 |
| InChIKey | OBAGHLULLMRECO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|