C10H9N5O — CID 81177285
3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 81177285) has the molecular formula C10H9N5O and a molecular weight of 215.22 g/mol. Its IUPAC name is 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 81177285 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | Nc1nc2cccnc2n1Cc1ccon1 |
| InChI | InChI=1S/C10H9N5O/c11-10-13-8-2-1-4-12-9(8)15(10)6-7-3-5-16-14-7/h1-5H,6H2,(H2,11,13) |
| InChIKey | OMBHPTKPPGJRAK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |