About 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine
3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine (PubChem CID 81177285) has the molecular formula C10H9N5O
and a molecular weight of 215.22 g/mol. Its IUPAC name is 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine.
Molecular Properties
| Compound Name | 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine |
| PubChem CID | 81177285 |
| Molecular Formula | C10H9N5O |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.08 |
| IUPAC Name | 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine |
| SMILES | Nc1nc2cccnc2n1Cc1ccon1 |
| InChI | InChI=1S/C10H9N5O/c11-10-13-8-2-1-4-12-9(8)15(10)6-7-3-5-16-14-7/h1-5H,6H2,(H2,11,13) |
| InChIKey | OMBHPTKPPGJRAK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine?
The IUPAC name of 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine (CID 81177285) is 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine.
What is the SMILES notation for 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine?
The canonical SMILES for 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine is Nc1nc2cccnc2n1Cc1ccon1.
What is the InChIKey of 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine?
The InChIKey is OMBHPTKPPGJRAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N5O/c11-10-13-8-2-1-4-12-9(8)15(10)6-7-3-5-16-14-7/h1-5H,6H2,(H2,11,13).
What are the key properties of 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine?
3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine has a molecular weight of 215.22 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-oxazol-3-ylmethyl)imidazo[4,5-b]pyridin-2-amine is sourced from PubChem (CID 81177285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).