C16H16FNO2S — CID 81185747
3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfinyl]-5-fluoroaniline (PubChem CID 81185747) has the molecular formula C16H16FNO2S and a molecular weight of 305.37 g/mol. Its IUPAC name is 3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfinyl]-5-fluoroaniline.
| Compound Name | 3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfinyl]-5-fluoroaniline |
|---|---|
| PubChem CID | 81185747 |
| Molecular Formula | C16H16FNO2S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 3-[2-(2,3-dihydro-1-benzofuran-5-yl)ethylsulfinyl]-5-fluoroaniline |
| SMILES | Nc1cc(F)cc(S(=O)CCc2ccc3c(c2)CCO3)c1 |
| InChI | InChI=1S/C16H16FNO2S/c17-13-8-14(18)10-15(9-13)21(19)6-4-11-1-2-16-12(7-11)3-5-20-16/h1-2,7-10H,3-6,18H2 |
| InChIKey | BWEMPNYBGCCVBM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|